C11H9FN2O3 — CID 117344219
3-(6-fluoro-4H-1,3-benzodioxin-5-yl)-1,2-oxazol-5-amine (PubChem CID 117344219) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 3-(6-fluoro-4H-1,3-benzodioxin-5-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(6-fluoro-4H-1,3-benzodioxin-5-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117344219 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(6-fluoro-4H-1,3-benzodioxin-5-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2c(F)ccc3c2COCO3)no1 |
| InChI | InChI=1S/C11H9FN2O3/c12-7-1-2-9-6(4-15-5-16-9)11(7)8-3-10(13)17-14-8/h1-3H,4-5,13H2 |
| InChIKey | OJAQKFBPBZHRTJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |