C11H10F2N2O — CID 117321351
3-(3-ethyl-2,6-difluorophenyl)-1,2-oxazol-5-amine (PubChem CID 117321351) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-(3-ethyl-2,6-difluorophenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-ethyl-2,6-difluorophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117321351 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(3-ethyl-2,6-difluorophenyl)-1,2-oxazol-5-amine |
| SMILES | CCc1ccc(F)c(-c2cc(N)on2)c1F |
| InChI | InChI=1S/C11H10F2N2O/c1-2-6-3-4-7(12)10(11(6)13)8-5-9(14)16-15-8/h3-5H,2,14H2,1H3 |
| InChIKey | OPAMFSVMTYKYCJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |