C10H9FN2O2 — CID 136998707
6-(5-amino-1,2-oxazol-3-yl)-2-fluoro-3-methylphenol (PubChem CID 136998707) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 6-(5-amino-1,2-oxazol-3-yl)-2-fluoro-3-methylphenol.
| Compound Name | 6-(5-amino-1,2-oxazol-3-yl)-2-fluoro-3-methylphenol |
|---|---|
| PubChem CID | 136998707 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 6-(5-amino-1,2-oxazol-3-yl)-2-fluoro-3-methylphenol |
| SMILES | Cc1ccc(-c2cc(N)on2)c(O)c1F |
| InChI | InChI=1S/C10H9FN2O2/c1-5-2-3-6(10(14)9(5)11)7-4-8(12)15-13-7/h2-4,14H,12H2,1H3 |
| InChIKey | OYRKWQMQAXKZQT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |