C9H10F3NOS — CID 117346251
N-methoxy-1-(2,3,5-trifluoro-4-methylsulfanylphenyl)methanamine (PubChem CID 117346251) has the molecular formula C9H10F3NOS and a molecular weight of 237.25 g/mol. Its IUPAC name is N-methoxy-1-(2,3,5-trifluoro-4-methylsulfanylphenyl)methanamine.
| Compound Name | N-methoxy-1-(2,3,5-trifluoro-4-methylsulfanylphenyl)methanamine |
|---|---|
| PubChem CID | 117346251 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | N-methoxy-1-(2,3,5-trifluoro-4-methylsulfanylphenyl)methanamine |
| SMILES | CONCc1cc(F)c(SC)c(F)c1F |
| InChI | InChI=1S/C9H10F3NOS/c1-14-13-4-5-3-6(10)9(15-2)8(12)7(5)11/h3,13H,4H2,1-2H3 |
| InChIKey | CTQDTGLJJOZMJW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|