C13H13F2NO — CID 117346297
2-(4,6-difluoro-1-benzofuran-5-yl)-2-methylpyrrolidine (PubChem CID 117346297) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(4,6-difluoro-1-benzofuran-5-yl)-2-methylpyrrolidine.
| Compound Name | 2-(4,6-difluoro-1-benzofuran-5-yl)-2-methylpyrrolidine |
|---|---|
| PubChem CID | 117346297 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(4,6-difluoro-1-benzofuran-5-yl)-2-methylpyrrolidine |
| SMILES | CC1(c2c(F)cc3occc3c2F)CCCN1 |
| InChI | InChI=1S/C13H13F2NO/c1-13(4-2-5-16-13)11-9(14)7-10-8(12(11)15)3-6-17-10/h3,6-7,16H,2,4-5H2,1H3 |
| InChIKey | BQRJYVYYZXPNSB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |