About methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate
methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate (PubChem CID 117347120) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate.
Analyze methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate?
The IUPAC name of methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate (CID 117347120) is methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate.
What is the SMILES notation for methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate?
The canonical SMILES for methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate is CNCC(O)c1cc(C)c(C)c(C(=O)OC)c1.
What is the InChIKey of methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate?
The InChIKey is LXZSIVHPDITHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-8-5-10(12(15)7-14-3)6-11(9(8)2)13(16)17-4/h5-6,12,14-15H,7H2,1-4H3.
What are the key properties of methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate?
methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate has a molecular weight of 237.30 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-hydroxy-2-(methylamino)ethyl]-2,3-dimethylbenzoate is sourced from PubChem (CID 117347120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).