C11H8ClNO3 — CID 117347933
5-(2-chloro-4-methylphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117347933) has the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. Its IUPAC name is 5-(2-chloro-4-methylphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2-chloro-4-methylphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117347933 |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-(2-chloro-4-methylphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)no2)c(Cl)c1 |
| InChI | InChI=1S/C11H8ClNO3/c1-6-2-3-7(8(12)4-6)10-5-9(11(14)15)13-16-10/h2-5H,1H3,(H,14,15) |
| InChIKey | VCDFCOIEOLJDBV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |