5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid

C12H11NO4 — CID 137007313

IUPAC5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid
SMILESCc1ccc(-c2cc(C(=O)O)no2)c(O)c1C
InChIInChI=1S/C12H11NO4/c1-6-3-4-8(11(14)7(6)2)10-5-9(12(15)16)13-17-10/h3-5,14H,1-2H3,(H,15,16)
InChIKeyZKSAXYZQFJTMEH-UHFFFAOYSA-N
MW233.22 g/mol
LogP2.36
Rot. Bonds2

About 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid

5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 137007313) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid
PubChem CID137007313
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid
SMILESCc1ccc(-c2cc(C(=O)O)no2)c(O)c1C
InChIInChI=1S/C12H11NO4/c1-6-3-4-8(11(14)7(6)2)10-5-9(12(15)16)13-17-10/h3-5,14H,1-2H3,(H,15,16)
InChIKeyZKSAXYZQFJTMEH-UHFFFAOYSA-N
XLogP2.36
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 52.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid (CID 137007313) is 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid is Cc1ccc(-c2cc(C(=O)O)no2)c(O)c1C.
What is the InChIKey of 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is ZKSAXYZQFJTMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-6-3-4-8(11(14)7(6)2)10-5-9(12(15)16)13-17-10/h3-5,14H,1-2H3,(H,15,16).
What are the key properties of 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid?
5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 233.22 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxy-3,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 137007313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).