C14H19FO2 — CID 117349432
3-[3-(2-fluoropropyl)phenyl]-3-methylbutanoic acid (PubChem CID 117349432) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 3-[3-(2-fluoropropyl)phenyl]-3-methylbutanoic acid.
| Compound Name | 3-[3-(2-fluoropropyl)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117349432 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-[3-(2-fluoropropyl)phenyl]-3-methylbutanoic acid |
| SMILES | CC(F)Cc1cccc(C(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C14H19FO2/c1-10(15)7-11-5-4-6-12(8-11)14(2,3)9-13(16)17/h4-6,8,10H,7,9H2,1-3H3,(H,16,17) |
| InChIKey | NCQQUQNPQUSKAF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |