C10H7ClN2O3 — CID 117349722
4-(6-chloro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine (PubChem CID 117349722) has the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. Its IUPAC name is 4-(6-chloro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(6-chloro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117349722 |
| Molecular Formula | C10H7ClN2O3 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 4-(6-chloro-1,3-benzodioxol-4-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1cc(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C10H7ClN2O3/c11-5-1-6(7-3-13-16-10(7)12)9-8(2-5)14-4-15-9/h1-3H,4,12H2 |
| InChIKey | ZAWZZNIYFQLDFD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |