C12H17NO2S — CID 117351535
3-(5-methoxy-1,3-benzoxathiol-6-yl)butan-1-amine (PubChem CID 117351535) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-(5-methoxy-1,3-benzoxathiol-6-yl)butan-1-amine.
| Compound Name | 3-(5-methoxy-1,3-benzoxathiol-6-yl)butan-1-amine |
|---|---|
| PubChem CID | 117351535 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-(5-methoxy-1,3-benzoxathiol-6-yl)butan-1-amine |
| SMILES | COc1cc2c(cc1C(C)CCN)OCS2 |
| InChI | InChI=1S/C12H17NO2S/c1-8(3-4-13)9-5-11-12(16-7-15-11)6-10(9)14-2/h5-6,8H,3-4,7,13H2,1-2H3 |
| InChIKey | UKFLICDYABQLIX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |