C13H17ClO2 — CID 117354218
4-chloro-2-[(1-hydroxycyclopropyl)methyl]-5-propan-2-ylphenol (PubChem CID 117354218) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 4-chloro-2-[(1-hydroxycyclopropyl)methyl]-5-propan-2-ylphenol.
| Compound Name | 4-chloro-2-[(1-hydroxycyclopropyl)methyl]-5-propan-2-ylphenol |
|---|---|
| PubChem CID | 117354218 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-chloro-2-[(1-hydroxycyclopropyl)methyl]-5-propan-2-ylphenol |
| SMILES | CC(C)c1cc(O)c(CC2(O)CC2)cc1Cl |
| InChI | InChI=1S/C13H17ClO2/c1-8(2)10-6-12(15)9(5-11(10)14)7-13(16)3-4-13/h5-6,8,15-16H,3-4,7H2,1-2H3 |
| InChIKey | ZFZODRCUXMDUHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |