C12H13F2NO2 — CID 117354606
4-[1-(1-aminoethyl)cyclopropyl]-2,3-difluorobenzoic acid (PubChem CID 117354606) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 4-[1-(1-aminoethyl)cyclopropyl]-2,3-difluorobenzoic acid.
| Compound Name | 4-[1-(1-aminoethyl)cyclopropyl]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 117354606 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-[1-(1-aminoethyl)cyclopropyl]-2,3-difluorobenzoic acid |
| SMILES | CC(N)C1(c2ccc(C(=O)O)c(F)c2F)CC1 |
| InChI | InChI=1S/C12H13F2NO2/c1-6(15)12(4-5-12)8-3-2-7(11(16)17)9(13)10(8)14/h2-3,6H,4-5,15H2,1H3,(H,16,17) |
| InChIKey | GLJNJEWDPVFKRP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |