About (E)-1,1-bis(ethylsulfanyl)hex-2-ene
(E)-1,1-bis(ethylsulfanyl)hex-2-ene (PubChem CID 11735866) has the molecular formula C10H20S2
and a molecular weight of 204.40 g/mol. Its IUPAC name is (E)-1,1-bis(ethylsulfanyl)hex-2-ene.
Molecular Properties
| Compound Name | (E)-1,1-bis(ethylsulfanyl)hex-2-ene |
| PubChem CID | 11735866 |
| Molecular Formula | C10H20S2 |
| Molecular Weight | 204.40 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (E)-1,1-bis(ethylsulfanyl)hex-2-ene |
| SMILES | CCC/C=C/C(SCC)SCC |
| InChI | InChI=1S/C10H20S2/c1-4-7-8-9-10(11-5-2)12-6-3/h8-10H,4-7H2,1-3H3/b9-8+ |
| InChIKey | JASIFHQVFZBHOP-CMDGGOBGSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1-bis(ethylsulfanyl)hex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1-bis(ethylsulfanyl)hex-2-ene?
The IUPAC name of (E)-1,1-bis(ethylsulfanyl)hex-2-ene (CID 11735866) is (E)-1,1-bis(ethylsulfanyl)hex-2-ene.
What is the SMILES notation for (E)-1,1-bis(ethylsulfanyl)hex-2-ene?
The canonical SMILES for (E)-1,1-bis(ethylsulfanyl)hex-2-ene is CCC/C=C/C(SCC)SCC.
What is the InChIKey of (E)-1,1-bis(ethylsulfanyl)hex-2-ene?
The InChIKey is JASIFHQVFZBHOP-CMDGGOBGSA-N. The full InChI is InChI=1S/C10H20S2/c1-4-7-8-9-10(11-5-2)12-6-3/h8-10H,4-7H2,1-3H3/b9-8+.
What are the key properties of (E)-1,1-bis(ethylsulfanyl)hex-2-ene?
(E)-1,1-bis(ethylsulfanyl)hex-2-ene has a molecular weight of 204.40 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1-bis(ethylsulfanyl)hex-2-ene is sourced from PubChem (CID 11735866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).