C12H15ClO3 — CID 117358681
3-(3-chloro-2,5-dimethoxy-4-methylphenyl)propanal (PubChem CID 117358681) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 3-(3-chloro-2,5-dimethoxy-4-methylphenyl)propanal.
| Compound Name | 3-(3-chloro-2,5-dimethoxy-4-methylphenyl)propanal |
|---|---|
| PubChem CID | 117358681 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-(3-chloro-2,5-dimethoxy-4-methylphenyl)propanal |
| SMILES | COc1cc(CCC=O)c(OC)c(Cl)c1C |
| InChI | InChI=1S/C12H15ClO3/c1-8-10(15-2)7-9(5-4-6-14)12(16-3)11(8)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | JQHTUDXZBAWPFY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|