C12H15F2NO2 — CID 117359415
3,4-difluoro-6-methoxy-2-piperidin-2-ylphenol (PubChem CID 117359415) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 3,4-difluoro-6-methoxy-2-piperidin-2-ylphenol.
| Compound Name | 3,4-difluoro-6-methoxy-2-piperidin-2-ylphenol |
|---|---|
| PubChem CID | 117359415 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3,4-difluoro-6-methoxy-2-piperidin-2-ylphenol |
| SMILES | COc1cc(F)c(F)c(C2CCCCN2)c1O |
| InChI | InChI=1S/C12H15F2NO2/c1-17-9-6-7(13)11(14)10(12(9)16)8-4-2-3-5-15-8/h6,8,15-16H,2-5H2,1H3 |
| InChIKey | YEAHVTNNRABOBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|