C11H14ClNO3 — CID 117361092
6-(1-aminocyclopentyl)-5-chlorobenzene-1,2,4-triol (PubChem CID 117361092) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 6-(1-aminocyclopentyl)-5-chlorobenzene-1,2,4-triol.
| Compound Name | 6-(1-aminocyclopentyl)-5-chlorobenzene-1,2,4-triol |
|---|---|
| PubChem CID | 117361092 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 6-(1-aminocyclopentyl)-5-chlorobenzene-1,2,4-triol |
| SMILES | NC1(c2c(O)c(O)cc(O)c2Cl)CCCC1 |
| InChI | InChI=1S/C11H14ClNO3/c12-9-6(14)5-7(15)10(16)8(9)11(13)3-1-2-4-11/h5,14-16H,1-4,13H2 |
| InChIKey | DITBECKQNDZCJH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|