C9H10BrNO2 — CID 117361687
(5-bromo-2,3-dihydro-1,4-benzodioxin-8-yl)methanamine (PubChem CID 117361687) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1,4-benzodioxin-8-yl)methanamine.
| Compound Name | (5-bromo-2,3-dihydro-1,4-benzodioxin-8-yl)methanamine |
|---|---|
| PubChem CID | 117361687 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | (5-bromo-2,3-dihydro-1,4-benzodioxin-8-yl)methanamine |
| SMILES | NCc1ccc(Br)c2c1OCCO2 |
| InChI | InChI=1S/C9H10BrNO2/c10-7-2-1-6(5-11)8-9(7)13-4-3-12-8/h1-2H,3-5,11H2 |
| InChIKey | AVZSYRMTJMKFOM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |