C12H17ClO3 — CID 117363911
2-(3-chloro-2,4-dimethoxy-5-methylphenyl)propan-1-ol (PubChem CID 117363911) has the molecular formula C12H17ClO3 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(3-chloro-2,4-dimethoxy-5-methylphenyl)propan-1-ol.
| Compound Name | 2-(3-chloro-2,4-dimethoxy-5-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117363911 |
| Molecular Formula | C12H17ClO3 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-(3-chloro-2,4-dimethoxy-5-methylphenyl)propan-1-ol |
| SMILES | COc1c(C)cc(C(C)CO)c(OC)c1Cl |
| InChI | InChI=1S/C12H17ClO3/c1-7-5-9(8(2)6-14)12(16-4)10(13)11(7)15-3/h5,8,14H,6H2,1-4H3 |
| InChIKey | GBVSDLWOLGACSO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |