C13H18F3N — CID 117365180
4-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]butan-1-amine (PubChem CID 117365180) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]butan-1-amine.
| Compound Name | 4-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 117365180 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]butan-1-amine |
| SMILES | CC(C)(F)c1cc(F)c(F)c(CCCCN)c1 |
| InChI | InChI=1S/C13H18F3N/c1-13(2,16)10-7-9(5-3-4-6-17)12(15)11(14)8-10/h7-8H,3-6,17H2,1-2H3 |
| InChIKey | ZYSMAHRYWJFNRB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|