C13H14N2O3 — CID 117367639
3-[3-(oxolan-3-yloxy)phenyl]-1,2-oxazol-5-amine (PubChem CID 117367639) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-[3-(oxolan-3-yloxy)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[3-(oxolan-3-yloxy)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117367639 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[3-(oxolan-3-yloxy)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cccc(OC3CCOC3)c2)no1 |
| InChI | InChI=1S/C13H14N2O3/c14-13-7-12(15-18-13)9-2-1-3-10(6-9)17-11-4-5-16-8-11/h1-3,6-7,11H,4-5,8,14H2 |
| InChIKey | RDAUDRWXZPTCGG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |