About ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate
ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate (PubChem CID 11736801) has the molecular formula C12H10O6
and a molecular weight of 250.21 g/mol. Its IUPAC name is ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate |
| PubChem CID | 11736801 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2cc(C)oc(=O)c2o1 |
| InChI | InChI=1S/C12H10O6/c1-3-16-11(14)9-5-8(13)7-4-6(2)17-12(15)10(7)18-9/h4-5H,3H2,1-2H3 |
| InChIKey | FMGHEBALCXNHPO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate?
The IUPAC name of ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate (CID 11736801) is ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate.
What is the SMILES notation for ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate?
The canonical SMILES for ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate is CCOC(=O)c1cc(=O)c2cc(C)oc(=O)c2o1.
What is the InChIKey of ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate?
The InChIKey is FMGHEBALCXNHPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O6/c1-3-16-11(14)9-5-8(13)7-4-6(2)17-12(15)10(7)18-9/h4-5H,3H2,1-2H3.
What are the key properties of ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate?
ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate has a molecular weight of 250.21 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-methyl-4,8-dioxopyrano[3,4-b]pyran-2-carboxylate is sourced from PubChem (CID 11736801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).