3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid

C14H17NO3 — CID 117370245

IUPAC3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid
SMILESCc1cc2c(O)c(CC(C)(C)C(=O)O)ccc2[nH]1
InChIInChI=1S/C14H17NO3/c1-8-6-10-11(15-8)5-4-9(12(10)16)7-14(2,3)13(17)18/h4-6,15-16H,7H2,1-3H3,(H,17,18)
InChIKeyJBNKFXCWXGGDQS-UHFFFAOYSA-N
MW247.29 g/mol
LogP2.84
Rot. Bonds3

About 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid

3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid (PubChem CID 117370245) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid
PubChem CID117370245
Molecular FormulaC14H17NO3
Molecular Weight247.29 g/mol
Exact Mass247.12
IUPAC Name3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid
SMILESCc1cc2c(O)c(CC(C)(C)C(=O)O)ccc2[nH]1
InChIInChI=1S/C14H17NO3/c1-8-6-10-11(15-8)5-4-9(12(10)16)7-14(2,3)13(17)18/h4-6,15-16H,7H2,1-3H3,(H,17,18)
InChIKeyJBNKFXCWXGGDQS-UHFFFAOYSA-N
XLogP2.84
TPSA73.32 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.29
LogP ≤ 52.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid (CID 117370245) is 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid is Cc1cc2c(O)c(CC(C)(C)C(=O)O)ccc2[nH]1.
What is the InChIKey of 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid?
The InChIKey is JBNKFXCWXGGDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-8-6-10-11(15-8)5-4-9(12(10)16)7-14(2,3)13(17)18/h4-6,15-16H,7H2,1-3H3,(H,17,18).
What are the key properties of 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid?
3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid has a molecular weight of 247.29 g/mol, XLogP of 2.84, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-2-methyl-1H-indol-5-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 117370245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).