C13H17N3O2 — CID 117370777
4-(3,5-dimethoxy-4-methylphenyl)-1-methylpyrazol-5-amine (PubChem CID 117370777) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-(3,5-dimethoxy-4-methylphenyl)-1-methylpyrazol-5-amine.
| Compound Name | 4-(3,5-dimethoxy-4-methylphenyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 117370777 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4-(3,5-dimethoxy-4-methylphenyl)-1-methylpyrazol-5-amine |
| SMILES | COc1cc(-c2cnn(C)c2N)cc(OC)c1C |
| InChI | InChI=1S/C13H17N3O2/c1-8-11(17-3)5-9(6-12(8)18-4)10-7-15-16(2)13(10)14/h5-7H,14H2,1-4H3 |
| InChIKey | FEFWPQGPKCFOSY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |