C13H14N4O2 — CID 117399239
5-(5-amino-1-methylpyrazol-4-yl)-2,3-dimethoxybenzonitrile (PubChem CID 117399239) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-(5-amino-1-methylpyrazol-4-yl)-2,3-dimethoxybenzonitrile.
| Compound Name | 5-(5-amino-1-methylpyrazol-4-yl)-2,3-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117399239 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-(5-amino-1-methylpyrazol-4-yl)-2,3-dimethoxybenzonitrile |
| SMILES | COc1cc(-c2cnn(C)c2N)cc(C#N)c1OC |
| InChI | InChI=1S/C13H14N4O2/c1-17-13(15)10(7-16-17)8-4-9(6-14)12(19-3)11(5-8)18-2/h4-5,7H,15H2,1-3H3 |
| InChIKey | LZMBZIQJSYHJCH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |