C12H13F2N3O2 — CID 117426009
4-(2,4-difluoro-3,5-dimethoxyphenyl)-1-methylpyrazol-5-amine (PubChem CID 117426009) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is 4-(2,4-difluoro-3,5-dimethoxyphenyl)-1-methylpyrazol-5-amine.
| Compound Name | 4-(2,4-difluoro-3,5-dimethoxyphenyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 117426009 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-(2,4-difluoro-3,5-dimethoxyphenyl)-1-methylpyrazol-5-amine |
| SMILES | COc1cc(-c2cnn(C)c2N)c(F)c(OC)c1F |
| InChI | InChI=1S/C12H13F2N3O2/c1-17-12(15)7(5-16-17)6-4-8(18-2)10(14)11(19-3)9(6)13/h4-5H,15H2,1-3H3 |
| InChIKey | OOXJZLPYLLUBQX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |