C11H11F2N3O — CID 117350174
4-(2,4-difluoro-6-methoxyphenyl)-1-methylpyrazol-5-amine (PubChem CID 117350174) has the molecular formula C11H11F2N3O and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-(2,4-difluoro-6-methoxyphenyl)-1-methylpyrazol-5-amine.
| Compound Name | 4-(2,4-difluoro-6-methoxyphenyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 117350174 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-(2,4-difluoro-6-methoxyphenyl)-1-methylpyrazol-5-amine |
| SMILES | COc1cc(F)cc(F)c1-c1cnn(C)c1N |
| InChI | InChI=1S/C11H11F2N3O/c1-16-11(14)7(5-15-16)10-8(13)3-6(12)4-9(10)17-2/h3-5H,14H2,1-2H3 |
| InChIKey | XSTKEBKUZOEHRK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |