C12H10ClN3O — CID 117372446
4-(7-chloro-3-methyl-1H-indol-5-yl)-1,2-oxazol-5-amine (PubChem CID 117372446) has the molecular formula C12H10ClN3O and a molecular weight of 247.69 g/mol. Its IUPAC name is 4-(7-chloro-3-methyl-1H-indol-5-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(7-chloro-3-methyl-1H-indol-5-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117372446 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-(7-chloro-3-methyl-1H-indol-5-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1c[nH]c2c(Cl)cc(-c3cnoc3N)cc12 |
| InChI | InChI=1S/C12H10ClN3O/c1-6-4-15-11-8(6)2-7(3-10(11)13)9-5-16-17-12(9)14/h2-5,15H,14H2,1H3 |
| InChIKey | MSRAUUFOCWUNPT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |