C13H12FN3O — CID 117364560
4-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-1,2-oxazol-5-amine (PubChem CID 117364560) has the molecular formula C13H12FN3O and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117364560 |
| Molecular Formula | C13H12FN3O |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-(7-fluoro-2,3-dimethyl-1H-indol-5-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1[nH]c2c(F)cc(-c3cnoc3N)cc2c1C |
| InChI | InChI=1S/C13H12FN3O/c1-6-7(2)17-12-9(6)3-8(4-11(12)14)10-5-16-18-13(10)15/h3-5,17H,15H2,1-2H3 |
| InChIKey | IHONBYPJYUOMIU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|