C12H12N2O4 — CID 117372986
2-(4-methyl-2,3-dioxopiperazin-1-yl)benzoic acid (PubChem CID 117372986) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-(4-methyl-2,3-dioxopiperazin-1-yl)benzoic acid.
| Compound Name | 2-(4-methyl-2,3-dioxopiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 117372986 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(4-methyl-2,3-dioxopiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2ccccc2C(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C12H12N2O4/c1-13-6-7-14(11(16)10(13)15)9-5-3-2-4-8(9)12(17)18/h2-5H,6-7H2,1H3,(H,17,18) |
| InChIKey | CKTYMOQKEPKKHZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|