C15H18N2O3 — CID 117438273
3-[2-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]butanal (PubChem CID 117438273) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[2-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]butanal.
| Compound Name | 3-[2-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]butanal |
|---|---|
| PubChem CID | 117438273 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[2-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]butanal |
| SMILES | CC(CC=O)c1ccccc1N1CCN(C)C(=O)C1=O |
| InChI | InChI=1S/C15H18N2O3/c1-11(7-10-18)12-5-3-4-6-13(12)17-9-8-16(2)14(19)15(17)20/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | BZEXOBLOEBZELM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|