C16H24O2 — CID 117374425
1-[(3-ethyl-2-methoxy-6-propan-2-ylphenyl)methyl]cyclopropan-1-ol (PubChem CID 117374425) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(3-ethyl-2-methoxy-6-propan-2-ylphenyl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(3-ethyl-2-methoxy-6-propan-2-ylphenyl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117374425 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-[(3-ethyl-2-methoxy-6-propan-2-ylphenyl)methyl]cyclopropan-1-ol |
| SMILES | CCc1ccc(C(C)C)c(CC2(O)CC2)c1OC |
| InChI | InChI=1S/C16H24O2/c1-5-12-6-7-13(11(2)3)14(15(12)18-4)10-16(17)8-9-16/h6-7,11,17H,5,8-10H2,1-4H3 |
| InChIKey | IJPXXYKPXJDKRU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |