C11H9ClN4O — CID 117374897
5-(3-chloro-1-methylindazol-5-yl)-1,2-oxazol-3-amine (PubChem CID 117374897) has the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. Its IUPAC name is 5-(3-chloro-1-methylindazol-5-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(3-chloro-1-methylindazol-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117374897 |
| Molecular Formula | C11H9ClN4O |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-(3-chloro-1-methylindazol-5-yl)-1,2-oxazol-3-amine |
| SMILES | Cn1nc(Cl)c2cc(-c3cc(N)no3)ccc21 |
| InChI | InChI=1S/C11H9ClN4O/c1-16-8-3-2-6(4-7(8)11(12)14-16)9-5-10(13)15-17-9/h2-5H,1H3,(H2,13,15) |
| InChIKey | LFUGYMZWZOAMCP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |