C8H9N3O — CID 82467912
5-(1-methylpyrrol-3-yl)-1,2-oxazol-3-amine (PubChem CID 82467912) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-(1-methylpyrrol-3-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(1-methylpyrrol-3-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 82467912 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5-(1-methylpyrrol-3-yl)-1,2-oxazol-3-amine |
| SMILES | Cn1ccc(-c2cc(N)no2)c1 |
| InChI | InChI=1S/C8H9N3O/c1-11-3-2-6(5-11)7-4-8(9)10-12-7/h2-5H,1H3,(H2,9,10) |
| InChIKey | WLJWXPXLCDAQJL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |