C8H8N2O2 — CID 114823937
5-(5-methylfuran-3-yl)-1,2-oxazol-3-amine (PubChem CID 114823937) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-(5-methylfuran-3-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(5-methylfuran-3-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 114823937 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-(5-methylfuran-3-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1cc(-c2cc(N)no2)co1 |
| InChI | InChI=1S/C8H8N2O2/c1-5-2-6(4-11-5)7-3-8(9)10-12-7/h2-4H,1H3,(H2,9,10) |
| InChIKey | XGKJFGSTHYDYMJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |