C8H6BrFO3 — CID 117375058
1-(2-bromo-3-fluoro-5,6-dihydroxyphenyl)ethanone (PubChem CID 117375058) has the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. Its IUPAC name is 1-(2-bromo-3-fluoro-5,6-dihydroxyphenyl)ethanone.
| Compound Name | 1-(2-bromo-3-fluoro-5,6-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 117375058 |
| Molecular Formula | C8H6BrFO3 |
| Molecular Weight | 249.03 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 1-(2-bromo-3-fluoro-5,6-dihydroxyphenyl)ethanone |
| SMILES | CC(=O)c1c(O)c(O)cc(F)c1Br |
| InChI | InChI=1S/C8H6BrFO3/c1-3(11)6-7(9)4(10)2-5(12)8(6)13/h2,12-13H,1H3 |
| InChIKey | DQQPEFLIQHLUHP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.03 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|