C11H11N3O4 — CID 117375297
3-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)propanoic acid (PubChem CID 117375297) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 3-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)propanoic acid.
| Compound Name | 3-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 117375297 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)propanoic acid |
| SMILES | NCC(C(=O)O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H11N3O4/c12-4-6(11(17)18)5-1-2-7-8(3-5)14-10(16)9(15)13-7/h1-3,6H,4,12H2,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | RFMYHRVRVFRTNQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|