C10H9N3O4 — CID 82389538
2-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)acetic acid (PubChem CID 82389538) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)acetic acid.
| Compound Name | 2-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)acetic acid |
|---|---|
| PubChem CID | 82389538 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-amino-2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)acetic acid |
| SMILES | NC(C(=O)O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H9N3O4/c11-7(10(16)17)4-1-2-5-6(3-4)13-9(15)8(14)12-5/h1-3,7H,11H2,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | DKTHMGCQKVVVPC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|