C16H14FN3O2 — CID 43823397
6-[1-amino-2-(4-fluorophenyl)ethyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 43823397) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 6-[1-amino-2-(4-fluorophenyl)ethyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[1-amino-2-(4-fluorophenyl)ethyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 43823397 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 6-[1-amino-2-(4-fluorophenyl)ethyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | NC(Cc1ccc(F)cc1)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H14FN3O2/c17-11-4-1-9(2-5-11)7-12(18)10-3-6-13-14(8-10)20-16(22)15(21)19-13/h1-6,8,12H,7,18H2,(H,19,21)(H,20,22) |
| InChIKey | SZFZVXMXOCPNIM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|