About 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid
3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid (PubChem CID 117376822) has the molecular formula C13H15NO2S
and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid |
| PubChem CID | 117376822 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid |
| SMILES | Cc1nsc2cccc(C(C)(C)CC(=O)O)c12 |
| InChI | InChI=1S/C13H15NO2S/c1-8-12-9(13(2,3)7-11(15)16)5-4-6-10(12)17-14-8/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | BXEZCQCKVZNVNY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid?
The IUPAC name of 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid (CID 117376822) is 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid.
What is the SMILES notation for 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid?
The canonical SMILES for 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid is Cc1nsc2cccc(C(C)(C)CC(=O)O)c12.
What is the InChIKey of 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid?
The InChIKey is BXEZCQCKVZNVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-8-12-9(13(2,3)7-11(15)16)5-4-6-10(12)17-14-8/h4-6H,7H2,1-3H3,(H,15,16).
What are the key properties of 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid?
3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid has a molecular weight of 249.34 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(3-methyl-1,2-benzothiazol-4-yl)butanoic acid is sourced from PubChem (CID 117376822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).