C14H18O2S — CID 117379817
3-(3,4-dihydro-2H-thiochromen-5-yl)-3-methylbutanoic acid (PubChem CID 117379817) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-5-yl)-3-methylbutanoic acid.
| Compound Name | 3-(3,4-dihydro-2H-thiochromen-5-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117379817 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-(3,4-dihydro-2H-thiochromen-5-yl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1cccc2c1CCCS2 |
| InChI | InChI=1S/C14H18O2S/c1-14(2,9-13(15)16)11-6-3-7-12-10(11)5-4-8-17-12/h3,6-7H,4-5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | MYYZDFYRHNEQPM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |