C16H24FN — CID 117377672
3-[[5-(2-fluoropropan-2-yl)-2-methylphenyl]methyl]piperidine (PubChem CID 117377672) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is 3-[[5-(2-fluoropropan-2-yl)-2-methylphenyl]methyl]piperidine.
| Compound Name | 3-[[5-(2-fluoropropan-2-yl)-2-methylphenyl]methyl]piperidine |
|---|---|
| PubChem CID | 117377672 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 3-[[5-(2-fluoropropan-2-yl)-2-methylphenyl]methyl]piperidine |
| SMILES | Cc1ccc(C(C)(C)F)cc1CC1CCCNC1 |
| InChI | InChI=1S/C16H24FN/c1-12-6-7-15(16(2,3)17)10-14(12)9-13-5-4-8-18-11-13/h6-7,10,13,18H,4-5,8-9,11H2,1-3H3 |
| InChIKey | OBFRLZZUZHRHDA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |