C12H14O9 — CID 11738171
[(1S,2S,3S,4R,5S)-2,4-diacetyloxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate (PubChem CID 11738171) has the molecular formula C12H14O9 and a molecular weight of 302.24 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S)-2,4-diacetyloxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,5S)-2,4-diacetyloxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
|---|---|
| PubChem CID | 11738171 |
| Molecular Formula | C12H14O9 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | [(1S,2S,3S,4R,5S)-2,4-diacetyloxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H]2OC(=O)[C@@H](O2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H14O9/c1-4(13)17-7-8(18-5(2)14)10(19-6(3)15)12-20-9(7)11(16)21-12/h7-10,12H,1-3H3/t7-,8-,9-,10+,12-/m0/s1 |
| InChIKey | QXBOEABOTCVRRP-GBVMLCMLSA-N |
| XLogP | -0.94 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|