C14H21NO3 — CID 117381755
2-[3-(1,2-dimethoxyethyl)phenyl]morpholine (PubChem CID 117381755) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[3-(1,2-dimethoxyethyl)phenyl]morpholine.
| Compound Name | 2-[3-(1,2-dimethoxyethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 117381755 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[3-(1,2-dimethoxyethyl)phenyl]morpholine |
| SMILES | COCC(OC)c1cccc(C2CNCCO2)c1 |
| InChI | InChI=1S/C14H21NO3/c1-16-10-14(17-2)12-5-3-4-11(8-12)13-9-15-6-7-18-13/h3-5,8,13-15H,6-7,9-10H2,1-2H3 |
| InChIKey | ACQDRNACUYFIHT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |