C16H17N3 — CID 117381867
1-(9H-pyrido[3,4-b]indol-6-yl)cyclopentan-1-amine (PubChem CID 117381867) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(9H-pyrido[3,4-b]indol-6-yl)cyclopentan-1-amine.
| Compound Name | 1-(9H-pyrido[3,4-b]indol-6-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 117381867 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-(9H-pyrido[3,4-b]indol-6-yl)cyclopentan-1-amine |
| SMILES | NC1(c2ccc3[nH]c4cnccc4c3c2)CCCC1 |
| InChI | InChI=1S/C16H17N3/c17-16(6-1-2-7-16)11-3-4-14-13(9-11)12-5-8-18-10-15(12)19-14/h3-5,8-10,19H,1-2,6-7,17H2 |
| InChIKey | ZEHOBWDQTFOHOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |