C16H17NO5 — CID 11738206
prop-2-enyl (2E,4E)-3-ethoxy-5-(4-nitrophenyl)penta-2,4-dienoate (PubChem CID 11738206) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is prop-2-enyl (2E,4E)-3-ethoxy-5-(4-nitrophenyl)penta-2,4-dienoate.
| Compound Name | prop-2-enyl (2E,4E)-3-ethoxy-5-(4-nitrophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 11738206 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | prop-2-enyl (2E,4E)-3-ethoxy-5-(4-nitrophenyl)penta-2,4-dienoate |
| SMILES | C=CCOC(=O)/C=C(\C=C\c1ccc([N+](=O)[O-])cc1)OCC |
| InChI | InChI=1S/C16H17NO5/c1-3-11-22-16(18)12-15(21-4-2)10-7-13-5-8-14(9-6-13)17(19)20/h3,5-10,12H,1,4,11H2,2H3/b10-7+,15-12+ |
| InChIKey | HDYMBGGEUHLFQP-CWEJARCISA-N |
| XLogP | 3.26 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|