C12H13ClN2O2 — CID 117384787
3-amino-2-(3-chloro-1-methylindol-5-yl)propanoic acid (PubChem CID 117384787) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-amino-2-(3-chloro-1-methylindol-5-yl)propanoic acid.
| Compound Name | 3-amino-2-(3-chloro-1-methylindol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 117384787 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-amino-2-(3-chloro-1-methylindol-5-yl)propanoic acid |
| SMILES | Cn1cc(Cl)c2cc(C(CN)C(=O)O)ccc21 |
| InChI | InChI=1S/C12H13ClN2O2/c1-15-6-10(13)8-4-7(2-3-11(8)15)9(5-14)12(16)17/h2-4,6,9H,5,14H2,1H3,(H,16,17) |
| InChIKey | KDEUGWJYYKGUHV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |