C11H11ClN4O2 — CID 117420645
3-amino-2-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]propanoic acid (PubChem CID 117420645) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 3-amino-2-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]propanoic acid.
| Compound Name | 3-amino-2-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117420645 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-amino-2-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]propanoic acid |
| SMILES | NCC(C(=O)O)c1ccc(-n2cncn2)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClN4O2/c12-9-3-7(8(4-13)11(17)18)1-2-10(9)16-6-14-5-15-16/h1-3,5-6,8H,4,13H2,(H,17,18) |
| InChIKey | NQIKXSBANFMBCK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |