5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid

C11H9F2N3O2 — CID 117385186

IUPAC5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid
SMILESCn1nc(-c2cc(C(=O)O)c(F)cc2F)cc1N
InChIInChI=1S/C11H9F2N3O2/c1-16-10(14)4-9(15-16)5-2-6(11(17)18)8(13)3-7(5)12/h2-4H,14H2,1H3,(H,17,18)
InChIKeyWVYYNYWFVHWOFU-UHFFFAOYSA-N
MW253.21 g/mol
LogP1.65
Rot. Bonds2

About 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid

5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid (PubChem CID 117385186) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid.

Molecular Properties

Compound Name5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid
PubChem CID117385186
Molecular FormulaC11H9F2N3O2
Molecular Weight253.21 g/mol
Exact Mass253.07
IUPAC Name5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid
SMILESCn1nc(-c2cc(C(=O)O)c(F)cc2F)cc1N
InChIInChI=1S/C11H9F2N3O2/c1-16-10(14)4-9(15-16)5-2-6(11(17)18)8(13)3-7(5)12/h2-4H,14H2,1H3,(H,17,18)
InChIKeyWVYYNYWFVHWOFU-UHFFFAOYSA-N
XLogP1.65
TPSA81.14 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.21
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid?
The IUPAC name of 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid (CID 117385186) is 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid.
What is the SMILES notation for 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid?
The canonical SMILES for 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid is Cn1nc(-c2cc(C(=O)O)c(F)cc2F)cc1N.
What is the InChIKey of 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid?
The InChIKey is WVYYNYWFVHWOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N3O2/c1-16-10(14)4-9(15-16)5-2-6(11(17)18)8(13)3-7(5)12/h2-4H,14H2,1H3,(H,17,18).
What are the key properties of 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid?
5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid has a molecular weight of 253.21 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-1-methylpyrazol-3-yl)-2,4-difluorobenzoic acid is sourced from PubChem (CID 117385186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).