C13H16FNO3 — CID 117385602
5-[1-(aminomethyl)cyclobutyl]-3-fluoro-2-methoxybenzoic acid (PubChem CID 117385602) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 5-[1-(aminomethyl)cyclobutyl]-3-fluoro-2-methoxybenzoic acid.
| Compound Name | 5-[1-(aminomethyl)cyclobutyl]-3-fluoro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 117385602 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 5-[1-(aminomethyl)cyclobutyl]-3-fluoro-2-methoxybenzoic acid |
| SMILES | COc1c(F)cc(C2(CN)CCC2)cc1C(=O)O |
| InChI | InChI=1S/C13H16FNO3/c1-18-11-9(12(16)17)5-8(6-10(11)14)13(7-15)3-2-4-13/h5-6H,2-4,7,15H2,1H3,(H,16,17) |
| InChIKey | BACNTFAUGPMUII-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |